C14H19N3O2 — CID 65284946
6-[(5-cyano-2-pyridinyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 65284946) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-[(5-cyano-2-pyridinyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(5-cyano-2-pyridinyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65284946 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-[(5-cyano-2-pyridinyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNc1ccc(C#N)cn1)CCC(=O)O |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,6-5-13(18)19)7-8-16-12-4-3-11(9-15)10-17-12/h3-4,10H,5-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | ZFSMEYNKHYMCSN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |