C15H22N4O2 — CID 67218178
[6-[(5-cyano-2-pyridinyl)amino]-2,2-dimethylhexan-3-yl] carbamate (PubChem CID 67218178) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is [6-[(5-cyano-2-pyridinyl)amino]-2,2-dimethylhexan-3-yl] carbamate.
| Compound Name | [6-[(5-cyano-2-pyridinyl)amino]-2,2-dimethylhexan-3-yl] carbamate |
|---|---|
| PubChem CID | 67218178 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [6-[(5-cyano-2-pyridinyl)amino]-2,2-dimethylhexan-3-yl] carbamate |
| SMILES | CC(C)(C)C(CCCNc1ccc(C#N)cn1)OC(N)=O |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,3)12(21-14(17)20)5-4-8-18-13-7-6-11(9-16)10-19-13/h6-7,10,12H,4-5,8H2,1-3H3,(H2,17,20)(H,18,19) |
| InChIKey | IWIKSFCZRVZCCR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|