About 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile
6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile (PubChem CID 95623512) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile |
| PubChem CID | 95623512 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile |
| SMILES | CC(C)(C)[C@H](O)CNc1ccc(C#N)cn1 |
| InChI | InChI=1S/C12H17N3O/c1-12(2,3)10(16)8-15-11-5-4-9(6-13)7-14-11/h4-5,7,10,16H,8H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | DIDWPOIOMNZORW-SNVBAGLBSA-N |
| XLogP | 1.77 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile?
The IUPAC name of 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile (CID 95623512) is 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile is CC(C)(C)[C@H](O)CNc1ccc(C#N)cn1.
What is the InChIKey of 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile?
The InChIKey is DIDWPOIOMNZORW-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H17N3O/c1-12(2,3)10(16)8-15-11-5-4-9(6-13)7-14-11/h4-5,7,10,16H,8H2,1-3H3,(H,14,15)/t10-/m1/s1.
What are the key properties of 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile?
6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile has a molecular weight of 219.29 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]pyridine-3-carbonitrile is sourced from PubChem (CID 95623512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).