C9H10N4O2 — CID 107257703
3-[(5-cyano-2-pyridinyl)amino]-2-hydroxypropanamide (PubChem CID 107257703) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 3-[(5-cyano-2-pyridinyl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(5-cyano-2-pyridinyl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107257703 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-[(5-cyano-2-pyridinyl)amino]-2-hydroxypropanamide |
| SMILES | N#Cc1ccc(NCC(O)C(N)=O)nc1 |
| InChI | InChI=1S/C9H10N4O2/c10-3-6-1-2-8(12-4-6)13-5-7(14)9(11)15/h1-2,4,7,14H,5H2,(H2,11,15)(H,12,13) |
| InChIKey | QBILHRNCTGCFRC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |