C12H18ClN3O2 — CID 114335451
6-[(6-chloropyrazin-2-yl)amino]-4,4-dimethylhexanoic acid (PubChem CID 114335451) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 6-[(6-chloropyrazin-2-yl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(6-chloropyrazin-2-yl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 114335451 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 6-[(6-chloropyrazin-2-yl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNc1cncc(Cl)n1)CCC(=O)O |
| InChI | InChI=1S/C12H18ClN3O2/c1-12(2,4-3-11(17)18)5-6-15-10-8-14-7-9(13)16-10/h7-8H,3-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | HCIDWAQCJBNYQN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |