C9H12ClN3O2 — CID 114335486
4-[(6-chloropyrazin-2-yl)amino]-2-methylbutanoic acid (PubChem CID 114335486) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is 4-[(6-chloropyrazin-2-yl)amino]-2-methylbutanoic acid.
| Compound Name | 4-[(6-chloropyrazin-2-yl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 114335486 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 4-[(6-chloropyrazin-2-yl)amino]-2-methylbutanoic acid |
| SMILES | CC(CCNc1cncc(Cl)n1)C(=O)O |
| InChI | InChI=1S/C9H12ClN3O2/c1-6(9(14)15)2-3-12-8-5-11-4-7(10)13-8/h4-6H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | ZMDZSZOTGAYMMM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |