C8H10ClN3O3 — CID 114335475
2-[2-[(6-chloropyrazin-2-yl)amino]ethoxy]acetic acid (PubChem CID 114335475) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is 2-[2-[(6-chloropyrazin-2-yl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(6-chloropyrazin-2-yl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 114335475 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-[2-[(6-chloropyrazin-2-yl)amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1cncc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O3/c9-6-3-10-4-7(12-6)11-1-2-15-5-8(13)14/h3-4H,1-2,5H2,(H,11,12)(H,13,14) |
| InChIKey | DXIBJSCQIAVSRX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|