About 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide
2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide (PubChem CID 154529689) has the molecular formula C23H25FN4O2
and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide.
Molecular Properties
| Compound Name | 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide |
| PubChem CID | 154529689 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide |
| SMILES | C/C(C=C(N)C(=O)Nc1ccc(OCC(C)(C)C)c(C#N)c1)=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN4O2/c1-15(27-18-7-5-17(24)6-8-18)11-20(26)22(29)28-19-9-10-21(16(12-19)13-25)30-14-23(2,3)4/h5-12H,14,26H2,1-4H3,(H,28,29)/b20-11?,27-15+ |
| InChIKey | VZYVNPRFOVYFFG-VLEYLASDSA-N |
| XLogP | 4.70 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide?
The IUPAC name of 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide (CID 154529689) is 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide.
What is the SMILES notation for 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide?
The canonical SMILES for 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide is C/C(C=C(N)C(=O)Nc1ccc(OCC(C)(C)C)c(C#N)c1)=N\c1ccc(F)cc1.
What is the InChIKey of 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide?
The InChIKey is VZYVNPRFOVYFFG-VLEYLASDSA-N. The full InChI is InChI=1S/C23H25FN4O2/c1-15(27-18-7-5-17(24)6-8-18)11-20(26)22(29)28-19-9-10-21(16(12-19)13-25)30-14-23(2,3)4/h5-12H,14,26H2,1-4H3,(H,28,29)/b20-11?,27-15+.
What are the key properties of 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide?
2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide has a molecular weight of 408.48 g/mol, XLogP of 4.70, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide is sourced from PubChem (CID 154529689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).