C23H25FN4O2 — CID 154529689
2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide (PubChem CID 154529689) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide.
| Compound Name | 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide |
|---|---|
| PubChem CID | 154529689 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-amino-N-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]-4-(4-fluorophenyl)iminopent-2-enamide |
| SMILES | C/C(C=C(N)C(=O)Nc1ccc(OCC(C)(C)C)c(C#N)c1)=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN4O2/c1-15(27-18-7-5-17(24)6-8-18)11-20(26)22(29)28-19-9-10-21(16(12-19)13-25)30-14-23(2,3)4/h5-12H,14,26H2,1-4H3,(H,28,29)/b20-11?,27-15+ |
| InChIKey | VZYVNPRFOVYFFG-VLEYLASDSA-N |
| XLogP | 4.70 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|