C27H33FN4O4 — CID 142010259
2-[3-cyano-4-(2,2-dimethylpropoxy)-N-[2-[(4-fluoroanilino)methyl]-3-iminobutanoyl]anilino]ethyl acetate (PubChem CID 142010259) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is 2-[3-cyano-4-(2,2-dimethylpropoxy)-N-[2-[(4-fluoroanilino)methyl]-3-iminobutanoyl]anilino]ethyl acetate.
| Compound Name | 2-[3-cyano-4-(2,2-dimethylpropoxy)-N-[2-[(4-fluoroanilino)methyl]-3-iminobutanoyl]anilino]ethyl acetate |
|---|---|
| PubChem CID | 142010259 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[3-cyano-4-(2,2-dimethylpropoxy)-N-[2-[(4-fluoroanilino)methyl]-3-iminobutanoyl]anilino]ethyl acetate |
| SMILES | [H]/N=C(\C)C(CNc1ccc(F)cc1)C(=O)N(CCOC(C)=O)c1ccc(OCC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C27H33FN4O4/c1-18(30)24(16-31-22-8-6-21(28)7-9-22)26(34)32(12-13-35-19(2)33)23-10-11-25(20(14-23)15-29)36-17-27(3,4)5/h6-11,14,24,30-31H,12-13,16-17H2,1-5H3/b30-18+ |
| InChIKey | BMGJTVVYQJFWOQ-UXHLAJHPSA-N |
| XLogP | 4.79 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|