C24H26FN4O4+ — CID 142010262
[(E)-3-[N-(carboxymethyl)-3-cyano-4-(2,2-dimethylpropoxy)anilino]-2-methanimidoyl-3-oxoprop-1-enyl]-(4-fluorophenyl)azanium (PubChem CID 142010262) has the molecular formula C24H26FN4O4+ and a molecular weight of 453.49 g/mol. Its IUPAC name is [(E)-3-[N-(carboxymethyl)-3-cyano-4-(2,2-dimethylpropoxy)anilino]-2-methanimidoyl-3-oxoprop-1-enyl]-(4-fluorophenyl)azanium.
| Compound Name | [(E)-3-[N-(carboxymethyl)-3-cyano-4-(2,2-dimethylpropoxy)anilino]-2-methanimidoyl-3-oxoprop-1-enyl]-(4-fluorophenyl)azanium |
|---|---|
| PubChem CID | 142010262 |
| Molecular Formula | C24H26FN4O4+ |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [(E)-3-[N-(carboxymethyl)-3-cyano-4-(2,2-dimethylpropoxy)anilino]-2-methanimidoyl-3-oxoprop-1-enyl]-(4-fluorophenyl)azanium |
| SMILES | [H]/N=C/C(=C\[NH2+]c1ccc(F)cc1)C(=O)N(CC(=O)O)c1ccc(OCC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C24H25FN4O4/c1-24(2,3)15-33-21-9-8-20(10-16(21)11-26)29(14-22(30)31)23(32)17(12-27)13-28-19-6-4-18(25)5-7-19/h4-10,12-13,27-28H,14-15H2,1-3H3,(H,30,31)/p+1/b17-13+,27-12+ |
| InChIKey | RXTWEKWLCXHUBP-RPYCCBOQSA-O |
| XLogP | 2.97 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|