C24H21FN4O — CID 174078454
4-[1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]-2-[(4-fluorophenyl)methoxy]benzonitrile (PubChem CID 174078454) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-[1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]-2-[(4-fluorophenyl)methoxy]benzonitrile.
| Compound Name | 4-[1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]-2-[(4-fluorophenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 174078454 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]-2-[(4-fluorophenyl)methoxy]benzonitrile |
| SMILES | [H]/N=C/C(=C(N)c1ccc(C#N)c(OCc2ccc(F)cc2)c1)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C24H21FN4O/c1-15-9-20(10-16(2)29-15)22(13-27)24(28)18-5-6-19(12-26)23(11-18)30-14-17-3-7-21(25)8-4-17/h3-11,13,27H,14,28H2,1-2H3/b24-22?,27-13+ |
| InChIKey | GBHKCIXGWVTRGZ-AZZKLCQWSA-N |
| XLogP | 4.76 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|