C24H22N4O — CID 168894648
3-[[3-[(Z)-1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]phenoxy]methyl]benzonitrile (PubChem CID 168894648) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-[[3-[(Z)-1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]phenoxy]methyl]benzonitrile.
| Compound Name | 3-[[3-[(Z)-1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 168894648 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[[3-[(Z)-1-amino-2-(2,6-dimethyl-4-pyridinyl)-3-iminoprop-1-enyl]phenoxy]methyl]benzonitrile |
| SMILES | [H]/N=C/C(=C(\N)c1cccc(OCc2cccc(C#N)c2)c1)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C24H22N4O/c1-16-9-21(10-17(2)28-16)23(14-26)24(27)20-7-4-8-22(12-20)29-15-19-6-3-5-18(11-19)13-25/h3-12,14,26H,15,27H2,1-2H3/b24-23+,26-14+ |
| InChIKey | XHKNTUGYOIURJY-IYHIJSKHSA-N |
| XLogP | 4.63 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|