C28H34N4O4 — CID 142010268
ethyl 2-[N-[3-amino-2-[(3-methylphenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]acetate (PubChem CID 142010268) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 2-[N-[3-amino-2-[(3-methylphenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]acetate.
| Compound Name | ethyl 2-[N-[3-amino-2-[(3-methylphenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]acetate |
|---|---|
| PubChem CID | 142010268 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | ethyl 2-[N-[3-amino-2-[(3-methylphenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]acetate |
| SMILES | CCOC(=O)CN(C(=O)C(/C=N/c1cccc(C)c1)=C(C)N)c1ccc(OCC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C28H34N4O4/c1-7-35-26(33)17-32(23-11-12-25(21(14-23)15-29)36-18-28(4,5)6)27(34)24(20(3)30)16-31-22-10-8-9-19(2)13-22/h8-14,16H,7,17-18,30H2,1-6H3/b24-20?,31-16+ |
| InChIKey | UTIJAPZEOAZSAW-JNLUMOPUSA-N |
| XLogP | 4.82 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|