C16H9F4IN2O2 — CID 55743956
N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-4-fluoro-2-iodobenzamide (PubChem CID 55743956) has the molecular formula C16H9F4IN2O2 and a molecular weight of 464.16 g/mol. Its IUPAC name is N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-4-fluoro-2-iodobenzamide.
| Compound Name | N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-4-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 55743956 |
| Molecular Formula | C16H9F4IN2O2 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-4-fluoro-2-iodobenzamide |
| SMILES | N#Cc1cc(NC(=O)c2ccc(F)cc2I)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C16H9F4IN2O2/c17-10-1-3-12(13(21)6-10)15(24)23-11-2-4-14(9(5-11)7-22)25-8-16(18,19)20/h1-6H,8H2,(H,23,24) |
| InChIKey | MUNBKQRDXQIOOI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|