C20H20F3N3O4S — CID 46487287
4-(tert-butylsulfamoyl)-N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]benzamide (PubChem CID 46487287) has the molecular formula C20H20F3N3O4S and a molecular weight of 455.46 g/mol. Its IUPAC name is 4-(tert-butylsulfamoyl)-N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]benzamide.
| Compound Name | 4-(tert-butylsulfamoyl)-N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 46487287 |
| Molecular Formula | C20H20F3N3O4S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-(tert-butylsulfamoyl)-N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)Nc2ccc(OCC(F)(F)F)c(C#N)c2)cc1 |
| InChI | InChI=1S/C20H20F3N3O4S/c1-19(2,3)26-31(28,29)16-7-4-13(5-8-16)18(27)25-15-6-9-17(14(10-15)11-24)30-12-20(21,22)23/h4-10,26H,12H2,1-3H3,(H,25,27) |
| InChIKey | ILLBTXSZGLFWNA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |