C18H15F3N2O4 — CID 55710580
N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dimethoxybenzamide (PubChem CID 55710580) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 55710580 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[3-cyano-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2ccc(OCC(F)(F)F)c(C#N)c2)c1 |
| InChI | InChI=1S/C18H15F3N2O4/c1-25-13-4-6-16(26-2)14(8-13)17(24)23-12-3-5-15(11(7-12)9-22)27-10-18(19,20)21/h3-8H,10H2,1-2H3,(H,23,24) |
| InChIKey | WUSDJXAFGIROTN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |