C19H22FN3O4S — CID 46603735
N-(3-acetamido-4-fluorophenyl)-4-(tert-butylsulfamoyl)benzamide (PubChem CID 46603735) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-4-(tert-butylsulfamoyl)benzamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-4-(tert-butylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46603735 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-4-(tert-butylsulfamoyl)benzamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)ccc1F |
| InChI | InChI=1S/C19H22FN3O4S/c1-12(24)21-17-11-14(7-10-16(17)20)22-18(25)13-5-8-15(9-6-13)28(26,27)23-19(2,3)4/h5-11,23H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | LIHYFGBVCXPQTE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |