C10H9ClF3N5 — CID 82227993
2-[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]ethanamine (PubChem CID 82227993) has the molecular formula C10H9ClF3N5 and a molecular weight of 291.66 g/mol. Its IUPAC name is 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]ethanamine.
| Compound Name | 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82227993 |
| Molecular Formula | C10H9ClF3N5 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]ethanamine |
| SMILES | NCCc1nnnn1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF3N5/c11-8-2-1-6(5-7(8)10(12,13)14)19-9(3-4-15)16-17-18-19/h1-2,5H,3-4,15H2 |
| InChIKey | JLDKZEYXXBFHJI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |