C10H11Cl2N5 — CID 82228072
3-[1-(3,5-dichlorophenyl)tetrazol-5-yl]propan-1-amine (PubChem CID 82228072) has the molecular formula C10H11Cl2N5 and a molecular weight of 272.14 g/mol. Its IUPAC name is 3-[1-(3,5-dichlorophenyl)tetrazol-5-yl]propan-1-amine.
| Compound Name | 3-[1-(3,5-dichlorophenyl)tetrazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 82228072 |
| Molecular Formula | C10H11Cl2N5 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-[1-(3,5-dichlorophenyl)tetrazol-5-yl]propan-1-amine |
| SMILES | NCCCc1nnnn1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2N5/c11-7-4-8(12)6-9(5-7)17-10(2-1-3-13)14-15-16-17/h4-6H,1-3,13H2 |
| InChIKey | VXLGTXWUHLKNFH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |