C11H10ClF3N4 — CID 82196888
[1-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyltriazol-4-yl]methanamine (PubChem CID 82196888) has the molecular formula C11H10ClF3N4 and a molecular weight of 290.68 g/mol. Its IUPAC name is [1-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyltriazol-4-yl]methanamine.
| Compound Name | [1-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyltriazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82196888 |
| Molecular Formula | C11H10ClF3N4 |
| Molecular Weight | 290.68 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [1-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyltriazol-4-yl]methanamine |
| SMILES | Cc1c(CN)nnn1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10ClF3N4/c1-6-10(5-16)17-18-19(6)7-2-3-9(12)8(4-7)11(13,14)15/h2-4H,5,16H2,1H3 |
| InChIKey | JXQUMTBTDWBHRA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |