C16H20FN3OS — CID 118356002
(R)-N-[(R)-(3-amino-4-fluorophenyl)-pyridin-4-ylmethyl]-2-methylpropane-2-sulfinamide (PubChem CID 118356002) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is (R)-N-[(R)-(3-amino-4-fluorophenyl)-pyridin-4-ylmethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(R)-(3-amino-4-fluorophenyl)-pyridin-4-ylmethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118356002 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (R)-N-[(R)-(3-amino-4-fluorophenyl)-pyridin-4-ylmethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](c1ccncc1)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C16H20FN3OS/c1-16(2,3)22(21)20-15(11-6-8-19-9-7-11)12-4-5-13(17)14(18)10-12/h4-10,15,20H,18H2,1-3H3/t15-,22+/m0/s1 |
| InChIKey | WPAZFEPUTFNWCL-OYHNWAKOSA-N |
| XLogP | 2.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|