C17H20BrClN2OS — CID 125499855
(R)-N-[(S)-(2-amino-5-bromophenyl)-(4-chlorophenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 125499855) has the molecular formula C17H20BrClN2OS and a molecular weight of 415.78 g/mol. Its IUPAC name is (R)-N-[(S)-(2-amino-5-bromophenyl)-(4-chlorophenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-(2-amino-5-bromophenyl)-(4-chlorophenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 125499855 |
| Molecular Formula | C17H20BrClN2OS |
| Molecular Weight | 415.78 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (R)-N-[(S)-(2-amino-5-bromophenyl)-(4-chlorophenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](c1ccc(Cl)cc1)c1cc(Br)ccc1N |
| InChI | InChI=1S/C17H20BrClN2OS/c1-17(2,3)23(22)21-16(11-4-7-13(19)8-5-11)14-10-12(18)6-9-15(14)20/h4-10,16,21H,20H2,1-3H3/t16-,23+/m0/s1 |
| InChIKey | OBHCUWBOCRQVMO-QMHKHESXSA-N |
| XLogP | 4.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|