C33H48NO2PSSi — CID 170920760
N-[2-diphenylphosphanyl-1-[2-tri(propan-2-yl)silyloxyphenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 170920760) has the molecular formula C33H48NO2PSSi and a molecular weight of 581.88 g/mol. Its IUPAC name is N-[2-diphenylphosphanyl-1-[2-tri(propan-2-yl)silyloxyphenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[2-diphenylphosphanyl-1-[2-tri(propan-2-yl)silyloxyphenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 170920760 |
| Molecular Formula | C33H48NO2PSSi |
| Molecular Weight | 581.88 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | N-[2-diphenylphosphanyl-1-[2-tri(propan-2-yl)silyloxyphenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)[Si](Oc1ccccc1C(CP(c1ccccc1)c1ccccc1)NS(=O)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H48NO2PSSi/c1-25(2)39(26(3)4,27(5)6)36-32-23-17-16-22-30(32)31(34-38(35)33(7,8)9)24-37(28-18-12-10-13-19-28)29-20-14-11-15-21-29/h10-23,25-27,31,34H,24H2,1-9H3 |
| InChIKey | IUYOKMGILWCTJY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.88 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|