C36H44NOPS — CID 162393755
N-[(1S)-2-diphenylphosphanyl-1-[2-[2,6-di(propan-2-yl)phenyl]phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 162393755) has the molecular formula C36H44NOPS and a molecular weight of 569.80 g/mol. Its IUPAC name is N-[(1S)-2-diphenylphosphanyl-1-[2-[2,6-di(propan-2-yl)phenyl]phenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-2-diphenylphosphanyl-1-[2-[2,6-di(propan-2-yl)phenyl]phenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162393755 |
| Molecular Formula | C36H44NOPS |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | N-[(1S)-2-diphenylphosphanyl-1-[2-[2,6-di(propan-2-yl)phenyl]phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccccc1[C@@H](CP(c1ccccc1)c1ccccc1)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C36H44NOPS/c1-26(2)30-23-16-24-31(27(3)4)35(30)33-22-15-14-21-32(33)34(37-40(38)36(5,6)7)25-39(28-17-10-8-11-18-28)29-19-12-9-13-20-29/h8-24,26-27,34,37H,25H2,1-7H3/t34-,40?/m1/s1 |
| InChIKey | RUXRACBSTFDZFD-RPZJXYERSA-N |
| XLogP | 8.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|