C39H50NO2PS — CID 178184062
(S)-N-[(1R)-1-[2-(3,5-ditert-butyl-4-methoxyphenyl)phenyl]-2-diphenylphosphanylethyl]-2-methylpropane-2-sulfinamide (PubChem CID 178184062) has the molecular formula C39H50NO2PS and a molecular weight of 627.88 g/mol. Its IUPAC name is (S)-N-[(1R)-1-[2-(3,5-ditert-butyl-4-methoxyphenyl)phenyl]-2-diphenylphosphanylethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-[2-(3,5-ditert-butyl-4-methoxyphenyl)phenyl]-2-diphenylphosphanylethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 178184062 |
| Molecular Formula | C39H50NO2PS |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | (S)-N-[(1R)-1-[2-(3,5-ditert-butyl-4-methoxyphenyl)phenyl]-2-diphenylphosphanylethyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1c(C(C)(C)C)cc(-c2ccccc2[C@H](CP(c2ccccc2)c2ccccc2)N[S@@](=O)C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C39H50NO2PS/c1-37(2,3)33-25-28(26-34(36(33)42-10)38(4,5)6)31-23-17-18-24-32(31)35(40-44(41)39(7,8)9)27-43(29-19-13-11-14-20-29)30-21-15-12-16-22-30/h11-26,35,40H,27H2,1-10H3/t35-,44-/m0/s1 |
| InChIKey | VXLTVDIYSIOQSB-BTDRIEDLSA-N |
| XLogP | 9.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|