C29H36NO6PS — CID 101209658
methyl (3S)-3-[4-[bis(phenylmethoxy)phosphorylmethyl]phenyl]-3-(tert-butylsulfinylamino)propanoate (PubChem CID 101209658) has the molecular formula C29H36NO6PS and a molecular weight of 557.65 g/mol. Its IUPAC name is methyl (3S)-3-[4-[bis(phenylmethoxy)phosphorylmethyl]phenyl]-3-(tert-butylsulfinylamino)propanoate.
| Compound Name | methyl (3S)-3-[4-[bis(phenylmethoxy)phosphorylmethyl]phenyl]-3-(tert-butylsulfinylamino)propanoate |
|---|---|
| PubChem CID | 101209658 |
| Molecular Formula | C29H36NO6PS |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | methyl (3S)-3-[4-[bis(phenylmethoxy)phosphorylmethyl]phenyl]-3-(tert-butylsulfinylamino)propanoate |
| SMILES | COC(=O)C[C@H](NS(=O)C(C)(C)C)c1ccc(CP(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H36NO6PS/c1-29(2,3)38(33)30-27(19-28(31)34-4)26-17-15-25(16-18-26)22-37(32,35-20-23-11-7-5-8-12-23)36-21-24-13-9-6-10-14-24/h5-18,27,30H,19-22H2,1-4H3/t27-,38?/m0/s1 |
| InChIKey | ZQTHNRWISSDMRY-ZVENJKCTSA-N |
| XLogP | 6.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|