C15H20F3NO4S — CID 168802536
methyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate (PubChem CID 168802536) has the molecular formula C15H20F3NO4S and a molecular weight of 367.39 g/mol. Its IUPAC name is methyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 168802536 |
| Molecular Formula | C15H20F3NO4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | methyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](N[S@](=O)C(C)(C)C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO4S/c1-14(2,3)24(21)19-12(9-13(20)22-4)10-6-5-7-11(8-10)23-15(16,17)18/h5-8,12,19H,9H2,1-4H3/t12-,24+/m0/s1 |
| InChIKey | KIXQXZRZWPPWCF-FNODVLLQSA-N |
| XLogP | 3.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |