C13H15F3N2O4 — CID 18518052
methyl 3-[(2-aminoacetyl)amino]-3-[3-(trifluoromethoxy)phenyl]propanoate (PubChem CID 18518052) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is methyl 3-[(2-aminoacetyl)amino]-3-[3-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl 3-[(2-aminoacetyl)amino]-3-[3-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 18518052 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 3-[(2-aminoacetyl)amino]-3-[3-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)CC(NC(=O)CN)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O4/c1-21-12(20)6-10(18-11(19)7-17)8-3-2-4-9(5-8)22-13(14,15)16/h2-5,10H,6-7,17H2,1H3,(H,18,19) |
| InChIKey | HHWZKJWRSYUWMQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |