C13H20O8P2 — CID 135389561
[1-hydroxy-2-[(1R,3R)-3-phenoxycyclopentyl]-1-phosphonoethyl]phosphonic acid (PubChem CID 135389561) has the molecular formula C13H20O8P2 and a molecular weight of 366.24 g/mol. Its IUPAC name is [1-hydroxy-2-[(1R,3R)-3-phenoxycyclopentyl]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [1-hydroxy-2-[(1R,3R)-3-phenoxycyclopentyl]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 135389561 |
| Molecular Formula | C13H20O8P2 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [1-hydroxy-2-[(1R,3R)-3-phenoxycyclopentyl]-1-phosphonoethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(O)(C[C@@H]1CC[C@@H](Oc2ccccc2)C1)P(=O)(O)O |
| InChI | InChI=1S/C13H20O8P2/c14-13(22(15,16)17,23(18,19)20)9-10-6-7-12(8-10)21-11-4-2-1-3-5-11/h1-5,10,12,14H,6-9H2,(H2,15,16,17)(H2,18,19,20)/t10-,12-/m1/s1 |
| InChIKey | OYFYPHYKEJDMKL-ZYHUDNBSSA-N |
| XLogP | 1.63 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|