About (4-phenoxycyclohexyl) carbamate
(4-phenoxycyclohexyl) carbamate (PubChem CID 69191754) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is (4-phenoxycyclohexyl) carbamate.
Molecular Properties
| Compound Name | (4-phenoxycyclohexyl) carbamate |
| PubChem CID | 69191754 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (4-phenoxycyclohexyl) carbamate |
| SMILES | NC(=O)OC1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C13H17NO3/c14-13(15)17-12-8-6-11(7-9-12)16-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H2,14,15) |
| InChIKey | XLVQNMFCXCQHQD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-phenoxycyclohexyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxycyclohexyl) carbamate?
The IUPAC name of (4-phenoxycyclohexyl) carbamate (CID 69191754) is (4-phenoxycyclohexyl) carbamate.
What is the SMILES notation for (4-phenoxycyclohexyl) carbamate?
The canonical SMILES for (4-phenoxycyclohexyl) carbamate is NC(=O)OC1CCC(Oc2ccccc2)CC1.
What is the InChIKey of (4-phenoxycyclohexyl) carbamate?
The InChIKey is XLVQNMFCXCQHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c14-13(15)17-12-8-6-11(7-9-12)16-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H2,14,15).
What are the key properties of (4-phenoxycyclohexyl) carbamate?
(4-phenoxycyclohexyl) carbamate has a molecular weight of 235.28 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxycyclohexyl) carbamate is sourced from PubChem (CID 69191754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).