About 4-phenoxypiperidin-1-ium
4-phenoxypiperidin-1-ium (PubChem CID 38988695) has the molecular formula C11H16NO+
and a molecular weight of 178.26 g/mol. Its IUPAC name is 4-phenoxypiperidin-1-ium.
Molecular Properties
| Compound Name | 4-phenoxypiperidin-1-ium |
| PubChem CID | 38988695 |
| Molecular Formula | C11H16NO+ |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 4-phenoxypiperidin-1-ium |
| SMILES | c1ccc(OC2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-5,11-12H,6-9H2/p+1 |
| InChIKey | KBYPITRKIJKGMD-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenoxypiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxypiperidin-1-ium?
The IUPAC name of 4-phenoxypiperidin-1-ium (CID 38988695) is 4-phenoxypiperidin-1-ium.
What is the SMILES notation for 4-phenoxypiperidin-1-ium?
The canonical SMILES for 4-phenoxypiperidin-1-ium is c1ccc(OC2CC[NH2+]CC2)cc1.
What is the InChIKey of 4-phenoxypiperidin-1-ium?
The InChIKey is KBYPITRKIJKGMD-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H15NO/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-5,11-12H,6-9H2/p+1.
What are the key properties of 4-phenoxypiperidin-1-ium?
4-phenoxypiperidin-1-ium has a molecular weight of 178.26 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxypiperidin-1-ium is sourced from PubChem (CID 38988695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).