C11H14N2O2 — CID 175784716
4-phenoxypyrrolidine-2-carboxamide (PubChem CID 175784716) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | 4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175784716 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-phenoxypyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CC(Oc2ccccc2)CN1 |
| InChI | InChI=1S/C11H14N2O2/c12-11(14)10-6-9(7-13-10)15-8-4-2-1-3-5-8/h1-5,9-10,13H,6-7H2,(H2,12,14) |
| InChIKey | IOGUTXMUGASONC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |