C12H13NO5 — CID 58003784
(2S,4S)-4-(4-carboxyphenoxy)pyrrolidine-2-carboxylic acid (PubChem CID 58003784) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is (2S,4S)-4-(4-carboxyphenoxy)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(4-carboxyphenoxy)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58003784 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (2S,4S)-4-(4-carboxyphenoxy)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(O[C@@H]2CN[C@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C12H13NO5/c14-11(15)7-1-3-8(4-2-7)18-9-5-10(12(16)17)13-6-9/h1-4,9-10,13H,5-6H2,(H,14,15)(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | BJPRWMACYVKYFR-UWVGGRQHSA-N |
| XLogP | 0.58 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |