C12H16N2O4S — CID 102037964
(2S,4S)-N-methylsulfonyl-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 102037964) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is (2S,4S)-N-methylsulfonyl-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-methylsulfonyl-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102037964 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2S,4S)-N-methylsulfonyl-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)[C@@H]1C[C@H](Oc2ccccc2)CN1 |
| InChI | InChI=1S/C12H16N2O4S/c1-19(16,17)14-12(15)11-7-10(8-13-11)18-9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | BNCZVLWZBMLCDD-QWRGUYRKSA-N |
| XLogP | -0.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |