C12H14ClNO3 — CID 26192738
methyl (2S,4S)-4-(3-chlorophenoxy)pyrrolidine-2-carboxylate (PubChem CID 26192738) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is methyl (2S,4S)-4-(3-chlorophenoxy)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-(3-chlorophenoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 26192738 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | methyl (2S,4S)-4-(3-chlorophenoxy)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](Oc2cccc(Cl)c2)CN1 |
| InChI | InChI=1S/C12H14ClNO3/c1-16-12(15)11-6-10(7-14-11)17-9-4-2-3-8(13)5-9/h2-5,10-11,14H,6-7H2,1H3/t10-,11-/m0/s1 |
| InChIKey | MFABJBRJYQHLSM-QWRGUYRKSA-N |
| XLogP | 1.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |