C15H21NO3 — CID 26192753
methyl (2S,4S)-4-(3-propan-2-ylphenoxy)pyrrolidine-2-carboxylate (PubChem CID 26192753) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (2S,4S)-4-(3-propan-2-ylphenoxy)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-(3-propan-2-ylphenoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 26192753 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (2S,4S)-4-(3-propan-2-ylphenoxy)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](Oc2cccc(C(C)C)c2)CN1 |
| InChI | InChI=1S/C15H21NO3/c1-10(2)11-5-4-6-12(7-11)19-13-8-14(16-9-13)15(17)18-3/h4-7,10,13-14,16H,8-9H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | JOXKDJLIALXZOZ-KBPBESRZSA-N |
| XLogP | 2.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |