C11H13BrN2O3 — CID 23595486
methyl 4-[(2-bromo-4-pyridinyl)oxy]pyrrolidine-2-carboxylate (PubChem CID 23595486) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is methyl 4-[(2-bromo-4-pyridinyl)oxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-[(2-bromo-4-pyridinyl)oxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 23595486 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | methyl 4-[(2-bromo-4-pyridinyl)oxy]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2ccnc(Br)c2)CN1 |
| InChI | InChI=1S/C11H13BrN2O3/c1-16-11(15)9-4-8(6-14-9)17-7-2-3-13-10(12)5-7/h2-3,5,8-9,14H,4,6H2,1H3 |
| InChIKey | MURRINNQDIBXEH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|