C12H13Cl2NO3 — CID 45075591
methyl (2S)-4-(2,4-dichlorophenoxy)pyrrolidine-2-carboxylate (PubChem CID 45075591) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl (2S)-4-(2,4-dichlorophenoxy)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-(2,4-dichlorophenoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 45075591 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl (2S)-4-(2,4-dichlorophenoxy)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(Oc2ccc(Cl)cc2Cl)CN1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-17-12(16)10-5-8(6-15-10)18-11-3-2-7(13)4-9(11)14/h2-4,8,10,15H,5-6H2,1H3/t8?,10-/m0/s1 |
| InChIKey | CRGZQEXVWHUMQC-HTLJXXAVSA-N |
| XLogP | 2.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |