C12H14Cl2N2O5 — CID 53410464
methyl 4-(4-chloro-2-nitrophenoxy)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 53410464) has the molecular formula C12H14Cl2N2O5 and a molecular weight of 337.16 g/mol. Its IUPAC name is methyl 4-(4-chloro-2-nitrophenoxy)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-(4-chloro-2-nitrophenoxy)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 53410464 |
| Molecular Formula | C12H14Cl2N2O5 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | methyl 4-(4-chloro-2-nitrophenoxy)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CC(Oc2ccc(Cl)cc2[N+](=O)[O-])CN1.Cl |
| InChI | InChI=1S/C12H13ClN2O5.ClH/c1-19-12(16)9-5-8(6-14-9)20-11-3-2-7(13)4-10(11)15(17)18;/h2-4,8-9,14H,5-6H2,1H3;1H |
| InChIKey | XPGFLTLETWVTOY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|