C13H14ClF3N2O5 — CID 126969482
methyl (2S,4R)-4-[2-nitro-4-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 126969482) has the molecular formula C13H14ClF3N2O5 and a molecular weight of 370.71 g/mol. Its IUPAC name is methyl (2S,4R)-4-[2-nitro-4-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl (2S,4R)-4-[2-nitro-4-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 126969482 |
| Molecular Formula | C13H14ClF3N2O5 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | methyl (2S,4R)-4-[2-nitro-4-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1C[C@@H](Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CN1.Cl |
| InChI | InChI=1S/C13H13F3N2O5.ClH/c1-22-12(19)9-5-8(6-17-9)23-11-3-2-7(13(14,15)16)4-10(11)18(20)21;/h2-4,8-9,17H,5-6H2,1H3;1H/t8-,9+;/m1./s1 |
| InChIKey | QUBIBRRPDOVUGM-RJUBDTSPSA-N |
| XLogP | 2.32 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|