C13H13F4NO3 — CID 46739869
methyl 4-[2-fluoro-3-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate (PubChem CID 46739869) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is methyl 4-[2-fluoro-3-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-[2-fluoro-3-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46739869 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | methyl 4-[2-fluoro-3-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2cccc(C(F)(F)F)c2F)CN1 |
| InChI | InChI=1S/C13H13F4NO3/c1-20-12(19)9-5-7(6-18-9)21-10-4-2-3-8(11(10)14)13(15,16)17/h2-4,7,9,18H,5-6H2,1H3 |
| InChIKey | XWFMUJLDNWIBCI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |