C13H14F3NO3 — CID 45075597
methyl (2S)-4-[2-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate (PubChem CID 45075597) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is methyl (2S)-4-[2-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-[2-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 45075597 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | methyl (2S)-4-[2-(trifluoromethyl)phenoxy]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(Oc2ccccc2C(F)(F)F)CN1 |
| InChI | InChI=1S/C13H14F3NO3/c1-19-12(18)10-6-8(7-17-10)20-11-5-3-2-4-9(11)13(14,15)16/h2-5,8,10,17H,6-7H2,1H3/t8?,10-/m0/s1 |
| InChIKey | XLLHBZJSDJWEIK-HTLJXXAVSA-N |
| XLogP | 1.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |