C18H20ClNO3 — CID 66523902
methyl (2S,4S)-4-(2-phenylphenoxy)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 66523902) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is methyl (2S,4S)-4-(2-phenylphenoxy)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl (2S,4S)-4-(2-phenylphenoxy)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 66523902 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | methyl (2S,4S)-4-(2-phenylphenoxy)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1C[C@H](Oc2ccccc2-c2ccccc2)CN1.Cl |
| InChI | InChI=1S/C18H19NO3.ClH/c1-21-18(20)16-11-14(12-19-16)22-17-10-6-5-9-15(17)13-7-3-2-4-8-13;/h2-10,14,16,19H,11-12H2,1H3;1H/t14-,16-;/m0./s1 |
| InChIKey | UIBWAZXOHOGHPN-DMLYUBSXSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |