C12H14BrCl2NO3 — CID 53410441
methyl 4-(4-bromo-2-chlorophenoxy)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 53410441) has the molecular formula C12H14BrCl2NO3 and a molecular weight of 371.06 g/mol. Its IUPAC name is methyl 4-(4-bromo-2-chlorophenoxy)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-(4-bromo-2-chlorophenoxy)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 53410441 |
| Molecular Formula | C12H14BrCl2NO3 |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | methyl 4-(4-bromo-2-chlorophenoxy)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CC(Oc2ccc(Br)cc2Cl)CN1.Cl |
| InChI | InChI=1S/C12H13BrClNO3.ClH/c1-17-12(16)10-5-8(6-15-10)18-11-3-2-7(13)4-9(11)14;/h2-4,8,10,15H,5-6H2,1H3;1H |
| InChIKey | OBULRYIHPHJVNQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |