C14H18ClNO4 — CID 53410433
methyl 4-(4-acetylphenoxy)pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 53410433) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is methyl 4-(4-acetylphenoxy)pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl 4-(4-acetylphenoxy)pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 53410433 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 4-(4-acetylphenoxy)pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CC(Oc2ccc(C(C)=O)cc2)CN1.Cl |
| InChI | InChI=1S/C14H17NO4.ClH/c1-9(16)10-3-5-11(6-4-10)19-12-7-13(15-8-12)14(17)18-2;/h3-6,12-13,15H,7-8H2,1-2H3;1H |
| InChIKey | FEAIEBOFKWWORY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |