C19H24Cl2N4O2 — CID 67667720
(2S)-N-(4-carbamimidoylphenyl)-N-methyl-4-phenoxypyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 67667720) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is (2S)-N-(4-carbamimidoylphenyl)-N-methyl-4-phenoxypyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-N-(4-carbamimidoylphenyl)-N-methyl-4-phenoxypyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 67667720 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (2S)-N-(4-carbamimidoylphenyl)-N-methyl-4-phenoxypyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(N(C)C(=O)[C@@H]2CC(Oc3ccccc3)CN2)cc1 |
| InChI | InChI=1S/C19H22N4O2.2ClH/c1-23(14-9-7-13(8-10-14)18(20)21)19(24)17-11-16(12-22-17)25-15-5-3-2-4-6-15;;/h2-10,16-17,22H,11-12H2,1H3,(H3,20,21);2*1H/t16?,17-;;/m0../s1 |
| InChIKey | SMNZWSGWSDVARC-FPUAHFBQSA-N |
| XLogP | 2.59 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|