C13H20O6P2 — CID 87099390
(5-methyl-1-phenyl-2-phosphonohex-4-en-2-yl)phosphonic acid (PubChem CID 87099390) has the molecular formula C13H20O6P2 and a molecular weight of 334.25 g/mol. Its IUPAC name is (5-methyl-1-phenyl-2-phosphonohex-4-en-2-yl)phosphonic acid.
| Compound Name | (5-methyl-1-phenyl-2-phosphonohex-4-en-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 87099390 |
| Molecular Formula | C13H20O6P2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (5-methyl-1-phenyl-2-phosphonohex-4-en-2-yl)phosphonic acid |
| SMILES | CC(C)=CCC(Cc1ccccc1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H20O6P2/c1-11(2)8-9-13(20(14,15)16,21(17,18)19)10-12-6-4-3-5-7-12/h3-8H,9-10H2,1-2H3,(H2,14,15,16)(H2,17,18,19) |
| InChIKey | SUUNYSCBNWAYSY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|