C16H18O4 — CID 174872595
3-acetyl-3-benzylheptane-2,4,6-trione (PubChem CID 174872595) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-acetyl-3-benzylheptane-2,4,6-trione.
| Compound Name | 3-acetyl-3-benzylheptane-2,4,6-trione |
|---|---|
| PubChem CID | 174872595 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-acetyl-3-benzylheptane-2,4,6-trione |
| SMILES | CC(=O)CC(=O)C(Cc1ccccc1)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C16H18O4/c1-11(17)9-15(20)16(12(2)18,13(3)19)10-14-7-5-4-6-8-14/h4-8H,9-10H2,1-3H3 |
| InChIKey | XAWYRKCUEPLWJV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|