C10H19N2O8P2+ — CID 137457201
[2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-4-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid (PubChem CID 137457201) has the molecular formula C10H19N2O8P2+ and a molecular weight of 357.22 g/mol. Its IUPAC name is [2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-4-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-4-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 137457201 |
| Molecular Formula | C10H19N2O8P2+ |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-4-yl]-1-hydroxy-1-phosphonoethyl]phosphonic acid |
| SMILES | NCC(O)C[n+]1ccc(CC(O)(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C10H18N2O8P2/c11-6-9(13)7-12-3-1-8(2-4-12)5-10(14,21(15,16)17)22(18,19)20/h1-4,9,13-14H,5-7,11H2,(H3-,15,16,17,18,19,20)/p+1 |
| InChIKey | YSBZRHVEZNXXAE-UHFFFAOYSA-O |
| XLogP | -2.16 |
| TPSA | 185.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|