C10H20N2O7P2+2 — CID 89220721
[2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-3-yl]-1-phosphonoethyl]-trihydroxyphosphanium (PubChem CID 89220721) has the molecular formula C10H20N2O7P2+2 and a molecular weight of 342.23 g/mol. Its IUPAC name is [2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-3-yl]-1-phosphonoethyl]-trihydroxyphosphanium.
| Compound Name | [2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-3-yl]-1-phosphonoethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 89220721 |
| Molecular Formula | C10H20N2O7P2+2 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [2-[1-(3-amino-2-hydroxypropyl)pyridin-1-ium-3-yl]-1-phosphonoethyl]-trihydroxyphosphanium |
| SMILES | NCC(O)C[n+]1cccc(CC(P(=O)(O)O)[P+](O)(O)O)c1 |
| InChI | InChI=1S/C10H18N2O7P2/c11-5-9(13)7-12-3-1-2-8(6-12)4-10(20(14,15)16)21(17,18)19/h1-3,6,9-10,13-16H,4-5,7,11H2/p+2 |
| InChIKey | KCPNLGUJRYBQAZ-UHFFFAOYSA-P |
| XLogP | -1.92 |
| TPSA | 168.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|